Difference between revisions of "CPD-11528"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-DEHYDRO-ASCORBATE == * common-name: ** l-dehydro-ascorbate * smiles: ** c(o)c(o)c1(c(=o)c(=o)c(=o)o1) * inchi-key: ** sbjkkffyizucet-sz...") |
(Created page with "Category:metabolite == Metabolite Holo-LYS2-peptidyl-carrier-protein == * common-name: ** a holo-[lys2 peptidyl-carrier-protein] == Reaction(s) known to consume the compou...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Holo-LYS2-peptidyl-carrier-protein == |
* common-name: | * common-name: | ||
| − | ** | + | ** a holo-[lys2 peptidyl-carrier-protein] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-16759]] | |
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-16759]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a holo-[lys2 peptidyl-carrier-protein]}} |
| − | |||
| − | |||
Revision as of 18:54, 14 January 2021
Contents
Metabolite Holo-LYS2-peptidyl-carrier-protein
- common-name:
- a holo-[lys2 peptidyl-carrier-protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a holo-[lys2 peptidyl-carrier-protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
