Difference between revisions of "CPD-11529"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19491 == * common-name: ** 3-isopropyl-6-(methylthio)-2-oxohexanoate * smiles: ** c(c(cccsc)c(=o)c(=o)[o-])(=o)[o-] * inchi-key: ** w...") |
(Created page with "Category:metabolite == Metabolite 13-BETA-D-GALACTOSYL-N-ACETYL-D-GLU == * common-name: ** a lactotetraosylceramide == Reaction(s) known to consume the compound == * GAL...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 13-BETA-D-GALACTOSYL-N-ACETYL-D-GLU == |
* common-name: | * common-name: | ||
| − | ** | + | ** a lactotetraosylceramide |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[GALACTOSIDE-2-L-FUCOSYLTRANSFERASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a lactotetraosylceramide}} |
| − | |||
| − | |||
Revision as of 11:13, 15 January 2021
Contents
Metabolite 13-BETA-D-GALACTOSYL-N-ACETYL-D-GLU
- common-name:
- a lactotetraosylceramide
