Difference between revisions of "CPD-11529"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite OCTADEC-9-ENE-118-DIOIC-ACID == * common-name: ** α,ω-9z-octadecenedioate * smiles: ** c(=o)([o-])cccccccc=ccccccccc(=o)[o-]...")
(Created page with "Category:metabolite == Metabolite CPD-11529 == * common-name: ** (+)-7-epi-jasmonoyl-coa * smiles: ** ccc=ccc1(c(=o)ccc1cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite OCTADEC-9-ENE-118-DIOIC-ACID ==
+
== Metabolite CPD-11529 ==
 
* common-name:
 
* common-name:
** α,ω-9z-octadecenedioate
+
** (+)-7-epi-jasmonoyl-coa
 
* smiles:
 
* smiles:
** c(=o)([o-])cccccccc=ccccccccc(=o)[o-]
+
** ccc=ccc1(c(=o)ccc1cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
 
* inchi-key:
 
* inchi-key:
** sblkviqsiheqof-uphrsurjsa-l
+
** wqkkcppndksaiu-cbgydujusa-j
 
* molecular-weight:
 
* molecular-weight:
** 310.433
+
** 955.76
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16418]]
+
* [[RXN-10708]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-10701]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α,ω-9z-octadecenedioate}}
+
{{#set: common-name=(+)-7-epi-jasmonoyl-coa}}
{{#set: inchi-key=inchikey=sblkviqsiheqof-uphrsurjsa-l}}
+
{{#set: inchi-key=inchikey=wqkkcppndksaiu-cbgydujusa-j}}
{{#set: molecular-weight=310.433}}
+
{{#set: molecular-weight=955.76}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-11529

  • common-name:
    • (+)-7-epi-jasmonoyl-coa
  • smiles:
    • ccc=ccc1(c(=o)ccc1cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
  • inchi-key:
    • wqkkcppndksaiu-cbgydujusa-j
  • molecular-weight:
    • 955.76

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality