Difference between revisions of "CPD-11529"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9088 == * smiles: ** ccc5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3...")
(Created page with "Category:metabolite == Metabolite CPD-11529 == * common-name: ** (+)-7-epi-jasmonoyl-coa * smiles: ** ccc=ccc1(c(=o)ccc1cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9088 ==
+
== Metabolite CPD-11529 ==
 +
* common-name:
 +
** (+)-7-epi-jasmonoyl-coa
 
* smiles:
 
* smiles:
** ccc5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=4)=cc5=6)))=cc8(=c(c)c(c(c)=o)=c(n78)c=9))))))
+
** ccc=ccc1(c(=o)ccc1cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
* common-name:
+
* inchi-key:
** geranylgeranyl bacteriochlorophyllide a
+
** wqkkcppndksaiu-cbgydujusa-j
 
* molecular-weight:
 
* molecular-weight:
** 904.462
+
** 955.76
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17426]]
+
* [[RXN-10708]]
* [[RXN-8789]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8788]]
+
* [[RXN-10701]]
* [[RXN-8789]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=geranylgeranyl bacteriochlorophyllide a}}
+
{{#set: common-name=(+)-7-epi-jasmonoyl-coa}}
{{#set: molecular-weight=904.462}}
+
{{#set: inchi-key=inchikey=wqkkcppndksaiu-cbgydujusa-j}}
 +
{{#set: molecular-weight=955.76}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-11529

  • common-name:
    • (+)-7-epi-jasmonoyl-coa
  • smiles:
    • ccc=ccc1(c(=o)ccc1cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
  • inchi-key:
    • wqkkcppndksaiu-cbgydujusa-j
  • molecular-weight:
    • 955.76

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality