Difference between revisions of "CPD-11529"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ18007 == * transcription-direction: ** positive * right-end-position: ** 478397 * left-end-position: ** 457779 * centisome-position: ** 69.73778...")
(Created page with "Category:metabolite == Metabolite CPD-11529 == * common-name: ** (+)-7-epi-jasmonoyl-coa * smiles: ** ccc=ccc1(c(=o)ccc1cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ18007 ==
+
== Metabolite CPD-11529 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** (+)-7-epi-jasmonoyl-coa
−
* right-end-position:
+
* smiles:
−
** 478397
+
** ccc=ccc1(c(=o)ccc1cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
−
* left-end-position:
+
* inchi-key:
−
** 457779
+
** wqkkcppndksaiu-cbgydujusa-j
−
* centisome-position:
+
* molecular-weight:
−
** 69.73778   
+
** 955.76
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-10708]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]]
+
* [[RXN-10701]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=(+)-7-epi-jasmonoyl-coa}}
−
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=wqkkcppndksaiu-cbgydujusa-j}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=955.76}}
−
* [[N-ACETYLTRANSFER-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN0-6948]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[ARGSYNBSUB-PWY]]
 
−
** '''9''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-5154]]
 
−
** '''8''' reactions found over '''9''' reactions in the full pathway
 
−
* [[GLUTORN-PWY]]
 
−
** '''5''' reactions found over '''5''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=478397}}
 
−
{{#set: left-end-position=457779}}
 
−
{{#set: centisome-position=69.73778    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=3}}
 
−
{{#set: nb pathway associated=3}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-11529

  • common-name:
    • (+)-7-epi-jasmonoyl-coa
  • smiles:
    • ccc=ccc1(c(=o)ccc1cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
  • inchi-key:
    • wqkkcppndksaiu-cbgydujusa-j
  • molecular-weight:
    • 955.76

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-11529&oldid=137038"