Difference between revisions of "CPD-11540"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ACETOL == * common-name: ** acetol * smiles: ** cc(=o)co * inchi-key: ** xlsmfkstngkwqx-uhfffaoysa-n * molecular-weight: ** 74.079 == Rea...") |
(Created page with "Category:metabolite == Metabolite CPD-11540 == * common-name: ** udp-4-dehydro-β-l-rhamnose * smiles: ** cc3(c(=o)c(o)c(o)c(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-11540 == |
* common-name: | * common-name: | ||
| − | ** | + | ** udp-4-dehydro-β-l-rhamnose |
* smiles: | * smiles: | ||
| − | ** cc(=o) | + | ** cc3(c(=o)c(o)c(o)c(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)o3) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ddwgqqadoimfoi-tyenrrdnsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 546.274 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-10740]] |
| − | * [[RXN- | + | * [[RXN-18332]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-18332]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=udp-4-dehydro-β-l-rhamnose}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ddwgqqadoimfoi-tyenrrdnsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=546.274}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-11540
- common-name:
- udp-4-dehydro-β-l-rhamnose
- smiles:
- cc3(c(=o)c(o)c(o)c(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)o3)
- inchi-key:
- ddwgqqadoimfoi-tyenrrdnsa-l
- molecular-weight:
- 546.274
