Difference between revisions of "CPD-11540"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ22265 == * transcription-direction: ** positive * right-end-position: ** 421755 * left-end-position: ** 419712 * centisome-position: ** 72.03168...") |
(Created page with "Category:metabolite == Metabolite CPD-11540 == * common-name: ** udp-4-dehydro-β-l-rhamnose * smiles: ** cc3(c(=o)c(o)c(o)c(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-11540 == |
| − | * | + | * common-name: |
| − | ** | + | ** udp-4-dehydro-β-l-rhamnose |
| − | + | * smiles: | |
| − | + | ** cc3(c(=o)c(o)c(o)c(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)o3) | |
| − | + | * inchi-key: | |
| − | + | ** ddwgqqadoimfoi-tyenrrdnsa-l | |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 546.274 |
| − | = | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-10740]] | |
| − | == | + | * [[RXN-18332]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[RXN-18332]] |
| − | ** | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=udp-4-dehydro-β-l-rhamnose}} | |
| − | * | + | {{#set: inchi-key=inchikey=ddwgqqadoimfoi-tyenrrdnsa-l}} |
| − | *** | + | {{#set: molecular-weight=546.274}} |
| − | == | ||
| − | * [[ | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-11540
- common-name:
- udp-4-dehydro-β-l-rhamnose
- smiles:
- cc3(c(=o)c(o)c(o)c(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)o3)
- inchi-key:
- ddwgqqadoimfoi-tyenrrdnsa-l
- molecular-weight:
- 546.274
