Difference between revisions of "CPD-11540"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ09395 == * transcription-direction: ** positive * right-end-position: ** 762070 * left-end-position: ** 758220 * centisome-position: ** 92.39182...")
(Created page with "Category:metabolite == Metabolite CPD-11540 == * common-name: ** udp-4-dehydro-β-l-rhamnose * smiles: ** cc3(c(=o)c(o)c(o)c(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ09395 ==
+
== Metabolite CPD-11540 ==
* transcription-direction:
+
* common-name:
** positive
+
** udp-4-dehydro-β-l-rhamnose
* right-end-position:
+
* smiles:
** 762070
+
** cc3(c(=o)c(o)c(o)c(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)o3)
* left-end-position:
+
* inchi-key:
** 758220
+
** ddwgqqadoimfoi-tyenrrdnsa-l
* centisome-position:
+
* molecular-weight:
** 92.39182   
+
** 546.274
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-10740]]
== Reaction(s) associated ==
+
* [[RXN-18332]]
* [[3.1.3.16-RXN]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
* [[RXN-18332]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
+
{{#set: common-name=udp-4-dehydro-β-l-rhamnose}}
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=ddwgqqadoimfoi-tyenrrdnsa-l}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=546.274}}
* [[PROTEIN-TYROSINE-PHOSPHATASE-RXN]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=762070}}
 
{{#set: left-end-position=758220}}
 
{{#set: centisome-position=92.39182    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=3}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-11540

  • common-name:
    • udp-4-dehydro-β-l-rhamnose
  • smiles:
    • cc3(c(=o)c(o)c(o)c(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)o3)
  • inchi-key:
    • ddwgqqadoimfoi-tyenrrdnsa-l
  • molecular-weight:
    • 546.274

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality