Difference between revisions of "CPD-11540"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ11469 == * transcription-direction: ** positive * right-end-position: ** 1271 * left-end-position: ** 56 * centisome-position: ** 1.506777700e-2 ==...") |
(Created page with "Category:metabolite == Metabolite CPD-11540 == * common-name: ** udp-4-dehydro-β-l-rhamnose * smiles: ** cc3(c(=o)c(o)c(o)c(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-11540 == |
− | * | + | * common-name: |
− | ** | + | ** udp-4-dehydro-β-l-rhamnose |
− | + | * smiles: | |
− | + | ** cc3(c(=o)c(o)c(o)c(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)o3) | |
− | + | * inchi-key: | |
− | + | ** ddwgqqadoimfoi-tyenrrdnsa-l | |
− | * | + | * molecular-weight: |
− | ** | + | ** 546.274 |
− | = | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-10740]] | |
− | == | + | * [[RXN-18332]] |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[RXN-18332]] |
− | ** | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=udp-4-dehydro-β-l-rhamnose}} | |
− | + | {{#set: inchi-key=inchikey=ddwgqqadoimfoi-tyenrrdnsa-l}} | |
− | + | {{#set: molecular-weight=546.274}} | |
− | * | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | ** | ||
− | |||
− | |||
− | == | ||
− | * [[ | ||
− | |||
− | |||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-11540
- common-name:
- udp-4-dehydro-β-l-rhamnose
- smiles:
- cc3(c(=o)c(o)c(o)c(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)o3)
- inchi-key:
- ddwgqqadoimfoi-tyenrrdnsa-l
- molecular-weight:
- 546.274