Difference between revisions of "CPD-11540"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18447 == * common-name: ** actinocin * smiles: ** cc1(=cc=c(c(=o)[o-])c2(n=c3(c(oc1=2)=c(c)c(=o)c(n)=c(c(=o)[o-])3))) * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite ASN-tRNAs == * common-name: ** trnaasn == Reaction(s) known to consume the compound == * ASPARAGINE--TRNA-LIGASE-RXN == Reaction(s) k...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite ASN-tRNAs == |
* common-name: | * common-name: | ||
− | ** | + | ** trnaasn |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[ASPARAGINE--TRNA-LIGASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-12460]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=trnaasn}} |
− | |||
− |
Revision as of 14:54, 5 January 2021
Contents
Metabolite ASN-tRNAs
- common-name:
- trnaasn