Difference between revisions of "CPD-11592"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite TAGATOSE-1-6-DIPHOSPHATE == * common-name: ** d-tagatofuranose 1,6-bisphosphate * smiles: ** c(op([o-])(=o)[o-])c1(oc(o)(cop([o-])([o-])=...")
(Created page with "Category:metabolite == Metabolite Charged-TYR-tRNAs == * common-name: ** an l-tyrosyl-[trnatyr] == Reaction(s) known to consume the compound == == Reaction(s) known to pro...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite TAGATOSE-1-6-DIPHOSPHATE ==
+
== Metabolite Charged-TYR-tRNAs ==
 
* common-name:
 
* common-name:
** d-tagatofuranose 1,6-bisphosphate
+
** an l-tyrosyl-[trnatyr]
* smiles:
 
** c(op([o-])(=o)[o-])c1(oc(o)(cop([o-])([o-])=o)c(o)c1o)
 
* inchi-key:
 
** rnbgygvwrkecfj-oexcpvawsa-j
 
* molecular-weight:
 
** 336.085
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[TAGAALDOL-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[TAGAKIN-RXN]]
+
* [[TYROSINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-tagatofuranose 1,6-bisphosphate}}
+
{{#set: common-name=an l-tyrosyl-[trnatyr]}}
{{#set: inchi-key=inchikey=rnbgygvwrkecfj-oexcpvawsa-j}}
 
{{#set: molecular-weight=336.085}}
 

Revision as of 11:15, 15 January 2021

Metabolite Charged-TYR-tRNAs

  • common-name:
    • an l-tyrosyl-[trnatyr]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an l-tyrosyl-[trnatyr" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.