Difference between revisions of "CPD-11608"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12125 == * common-name: ** menaquinol-7 * smiles: ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc2(c(c)=c(o)c1(c=cc=cc=1c(...")
(Created page with "Category:metabolite == Metabolite CPD-11608 == * common-name: ** β-sitosterol 3-o-β-d-glucoside * smiles: ** ccc(c(c)c)ccc(c)[ch]4(cc[ch]5([ch]3(cc=c2(cc(oc1(oc(...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12125 ==
+
== Metabolite CPD-11608 ==
 
* common-name:
 
* common-name:
** menaquinol-7
+
** β-sitosterol 3-o-β-d-glucoside
 
* smiles:
 
* smiles:
** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc2(c(c)=c(o)c1(c=cc=cc=1c(o)=2)))c
+
** ccc(c(c)c)ccc(c)[ch]4(cc[ch]5([ch]3(cc=c2(cc(oc1(oc(co)c(o)c(o)c(o)1))ccc(c)2[ch]3ccc(c)45))))
 
* inchi-key:
 
* inchi-key:
** vfgnpjrrtkmykn-ljwnyqgcsa-n
+
** npjictmalkltfw-kuenwnpssa-n
 
* molecular-weight:
 
* molecular-weight:
** 651.026
+
** 576.855
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9191]]
+
* [[RXN-12128]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=menaquinol-7}}
+
{{#set: common-name=β-sitosterol 3-o-β-d-glucoside}}
{{#set: inchi-key=inchikey=vfgnpjrrtkmykn-ljwnyqgcsa-n}}
+
{{#set: inchi-key=inchikey=npjictmalkltfw-kuenwnpssa-n}}
{{#set: molecular-weight=651.026}}
+
{{#set: molecular-weight=576.855}}

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-11608

  • common-name:
    • β-sitosterol 3-o-β-d-glucoside
  • smiles:
    • ccc(c(c)c)ccc(c)[ch]4(cc[ch]5([ch]3(cc=c2(cc(oc1(oc(co)c(o)c(o)c(o)1))ccc(c)2[ch]3ccc(c)45))))
  • inchi-key:
    • npjictmalkltfw-kuenwnpssa-n
  • molecular-weight:
    • 576.855

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality