Difference between revisions of "CPD-11647"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite trans-delta2-lignoceroyl-ACPs == * common-name: ** a trans-tetracos-2-enoyl-[acp] == Reaction(s) known to consume the compound == * RXN...") |
(Created page with "Category:metabolite == Metabolite CPD-11647 == * common-name: ** thermospermine * smiles: ** c([n+])ccc[n+]ccc[n+]ccc[n+] * inchi-key: ** doddbcgmrafleb-uhfffaoysa-r * mol...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-11647 == |
* common-name: | * common-name: | ||
| − | ** | + | ** thermospermine |
| + | * smiles: | ||
| + | ** c([n+])ccc[n+]ccc[n+]ccc[n+] | ||
| + | * inchi-key: | ||
| + | ** doddbcgmrafleb-uhfffaoysa-r | ||
| + | * molecular-weight: | ||
| + | ** 206.374 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-11190]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-11190]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=thermospermine}} |
| + | {{#set: inchi-key=inchikey=doddbcgmrafleb-uhfffaoysa-r}} | ||
| + | {{#set: molecular-weight=206.374}} | ||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-11647
- common-name:
- thermospermine
- smiles:
- c([n+])ccc[n+]ccc[n+]ccc[n+]
- inchi-key:
- doddbcgmrafleb-uhfffaoysa-r
- molecular-weight:
- 206.374
