Difference between revisions of "CPD-11665"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Sulfurated-Sulfur-Acceptors == * common-name: ** a sulfurated [sulfur carrier] == Reaction(s) known to consume the compound == * 2.8.1....")
(Created page with "Category:metabolite == Metabolite CPD-11665 == * common-name: ** serotonin o-sulfate * smiles: ** c(n)cc1(=cnc2(=c1c=c(os(=o)(=o)o)c=c2)) * inchi-key: ** jfwysggscoobgk-uh...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Sulfurated-Sulfur-Acceptors ==
+
== Metabolite CPD-11665 ==
 
* common-name:
 
* common-name:
** a sulfurated [sulfur carrier]
+
** serotonin o-sulfate
 +
* smiles:
 +
** c(n)cc1(=cnc2(=c1c=c(os(=o)(=o)o)c=c2))
 +
* inchi-key:
 +
** jfwysggscoobgk-uhfffaoysa-n
 +
* molecular-weight:
 +
** 256.276
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.8.1.6-RXN]]
 
* [[RXN-12587]]
 
* [[RXN-14480]]
 
* [[RXN-14950]]
 
* [[RXN-14957]]
 
* [[RXN-14959]]
 
* [[RXN-17472]]
 
* [[RXN0-5063]]
 
* [[RXN0-6359]]
 
* [[RXN0-949]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12587]]
+
* [[RXN-10777]]
* [[RXN-12588]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a sulfurated [sulfur carrier]}}
+
{{#set: common-name=serotonin o-sulfate}}
 +
{{#set: inchi-key=inchikey=jfwysggscoobgk-uhfffaoysa-n}}
 +
{{#set: molecular-weight=256.276}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-11665

  • common-name:
    • serotonin o-sulfate
  • smiles:
    • c(n)cc1(=cnc2(=c1c=c(os(=o)(=o)o)c=c2))
  • inchi-key:
    • jfwysggscoobgk-uhfffaoysa-n
  • molecular-weight:
    • 256.276

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality