Difference between revisions of "CPD-11671"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite HOMO-SER == * common-name: ** l-homoserine * smiles: ** c(co)c([n+])c([o-])=o * inchi-key: ** ukauyvftdyckqa-vkhmyheasa-n * molecular-wei...")
(Created page with "Category:metabolite == Metabolite CPD-11671 == * common-name: ** 5-hydroxytryptophol * smiles: ** c(o)cc1(=cnc2(=c1c=c(o)c=c2)) * inchi-key: ** kqrohcsyogbqgj-uhfffaoysa-n...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite HOMO-SER ==
+
== Metabolite CPD-11671 ==
 
* common-name:
 
* common-name:
** l-homoserine
+
** 5-hydroxytryptophol
 
* smiles:
 
* smiles:
** c(co)c([n+])c([o-])=o
+
** c(o)cc1(=cnc2(=c1c=c(o)c=c2))
 
* inchi-key:
 
* inchi-key:
** ukauyvftdyckqa-vkhmyheasa-n
+
** kqrohcsyogbqgj-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 119.12
+
** 177.202
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[CYSTATHIONASE-RXN]]
+
* [[RXN-10782]]
* [[HOMOSERDEAM-RXN]]
+
* [[RXN-10784]]
* [[HOMOSERINE-O-ACETYLTRANSFERASE-RXN]]
 
* [[HOMOSERKIN-RXN]]
 
* [[HOMSUCTRAN-RXN]]
 
* [[RXN-14049]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[CYSTATHIONASE-RXN]]
+
* [[RXN-10781]]
* [[HOMOSERDEHYDROG-RXN]]
 
* [[HOMOSERINE-O-ACETYLTRANSFERASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-homoserine}}
+
{{#set: common-name=5-hydroxytryptophol}}
{{#set: inchi-key=inchikey=ukauyvftdyckqa-vkhmyheasa-n}}
+
{{#set: inchi-key=inchikey=kqrohcsyogbqgj-uhfffaoysa-n}}
{{#set: molecular-weight=119.12}}
+
{{#set: molecular-weight=177.202}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-11671

  • common-name:
    • 5-hydroxytryptophol
  • smiles:
    • c(o)cc1(=cnc2(=c1c=c(o)c=c2))
  • inchi-key:
    • kqrohcsyogbqgj-uhfffaoysa-n
  • molecular-weight:
    • 177.202

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality