Difference between revisions of "CPD-11671"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ08733 == * transcription-direction: ** positive * right-end-position: ** 386156 * left-end-position: ** 379318 * centisome-position: ** 87.44035...")
(Created page with "Category:metabolite == Metabolite CPD-11671 == * common-name: ** 5-hydroxytryptophol * smiles: ** c(o)cc1(=cnc2(=c1c=c(o)c=c2)) * inchi-key: ** kqrohcsyogbqgj-uhfffaoysa-n...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ08733 ==
+
== Metabolite CPD-11671 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 5-hydroxytryptophol
−
* right-end-position:
+
* smiles:
−
** 386156
+
** c(o)cc1(=cnc2(=c1c=c(o)c=c2))
−
* left-end-position:
+
* inchi-key:
−
** 379318
+
** kqrohcsyogbqgj-uhfffaoysa-n
−
* centisome-position:
+
* molecular-weight:
−
** 87.44035   
+
** 177.202
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-10782]]
−
== Reaction(s) associated ==
+
* [[RXN-10784]]
−
* [[PHOSPHAGLYPSYN-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[RXN-10781]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
** Category: [[orthology]]
+
{{#set: common-name=5-hydroxytryptophol}}
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=kqrohcsyogbqgj-uhfffaoysa-n}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=177.202}}
−
== Pathway(s) associated ==
 
−
* [[PWY-5269]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY0-1545]]
 
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-5668]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY4FS-8]]
 
−
** '''3''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY4FS-7]]
 
−
** '''3''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-7817]]
 
−
** '''6''' reactions found over '''16''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=386156}}
 
−
{{#set: left-end-position=379318}}
 
−
{{#set: centisome-position=87.44035    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=1}}
 
−
{{#set: nb pathway associated=6}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-11671

  • common-name:
    • 5-hydroxytryptophol
  • smiles:
    • c(o)cc1(=cnc2(=c1c=c(o)c=c2))
  • inchi-key:
    • kqrohcsyogbqgj-uhfffaoysa-n
  • molecular-weight:
    • 177.202

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-11671&oldid=137943"