Difference between revisions of "CPD-11673"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ00779 == * transcription-direction: ** negative * right-end-position: ** 150411 * left-end-position: ** 138794 * centisome-position: ** 85.85656...")
(Created page with "Category:metabolite == Metabolite CPD-11673 == * common-name: ** 5-hydroxytryptophol glucuronide * smiles: ** c(o)cc1(=cnc3(=c1c=c(oc2(oc(c(=o)o)c(o)c(o)c(o)2))c=c3)) * in...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ00779 ==
+
== Metabolite CPD-11673 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** 5-hydroxytryptophol glucuronide
−
* right-end-position:
+
* smiles:
−
** 150411
+
** c(o)cc1(=cnc3(=c1c=c(oc2(oc(c(=o)o)c(o)c(o)c(o)2))c=c3))
−
* left-end-position:
+
* inchi-key:
−
** 138794
+
** nflhlwrxdoxscf-uhfffaoysa-n
−
* centisome-position:
+
* molecular-weight:
−
** 85.85656   
+
** 353.328
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[RXN-10784]]
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) of unknown directionality ==
−
* [[1.11.1.15-RXN]]
+
{{#set: common-name=5-hydroxytryptophol glucuronide}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=nflhlwrxdoxscf-uhfffaoysa-n}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=353.328}}
−
* [[PEROXID-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-14240]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-15288]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-17352]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-8635]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN0-5468]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7214]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-7445]]
 
−
** '''1''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-5466]]
 
−
** '''2''' reactions found over '''10''' reactions in the full pathway
 
−
* [[PWY-6824]]
 
−
** '''2''' reactions found over '''10''' reactions in the full pathway
 
−
* [[PWY-5469]]
 
−
** '''2''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-5461]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=150411}}
 
−
{{#set: left-end-position=138794}}
 
−
{{#set: centisome-position=85.85656    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=7}}
 
−
{{#set: nb pathway associated=6}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-11673

  • common-name:
    • 5-hydroxytryptophol glucuronide
  • smiles:
    • c(o)cc1(=cnc3(=c1c=c(oc2(oc(c(=o)o)c(o)c(o)c(o)2))c=c3))
  • inchi-key:
    • nflhlwrxdoxscf-uhfffaoysa-n
  • molecular-weight:
    • 353.328

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-11673&oldid=137345"