Difference between revisions of "CPD-11673"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ00779 == * transcription-direction: ** negative * right-end-position: ** 150411 * left-end-position: ** 138794 * centisome-position: ** 85.85656...") |
(Created page with "Category:metabolite == Metabolite CPD-13403 == * common-name: ** l-alanyl-l-glutamine * smiles: ** cc([n+])c(=o)nc(c([o-])=o)ccc(=o)n * inchi-key: ** hjcmdxdypoufdy-whfbia...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-13403 == |
| − | * | + | * common-name: |
| − | ** | + | ** l-alanyl-l-glutamine |
| − | + | * smiles: | |
| − | + | ** cc([n+])c(=o)nc(c([o-])=o)ccc(=o)n | |
| − | + | * inchi-key: | |
| − | + | ** hjcmdxdypoufdy-whfbiakzsa-n | |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 217.224 |
| − | + | == Reaction(s) known to consume the compound == | |
| − | + | * [[RXN0-6976]] | |
| − | == | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=l-alanyl-l-glutamine}} | |
| − | + | {{#set: inchi-key=inchikey=hjcmdxdypoufdy-whfbiakzsa-n}} | |
| − | + | {{#set: molecular-weight=217.224}} | |
| − | * | ||
| − | |||
| − | ** | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * | ||
| − | |||
| − | ** | ||
| − | |||
| − | == | ||
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Revision as of 20:31, 18 December 2020
Contents
Metabolite CPD-13403
- common-name:
- l-alanyl-l-glutamine
- smiles:
- cc([n+])c(=o)nc(c([o-])=o)ccc(=o)n
- inchi-key:
- hjcmdxdypoufdy-whfbiakzsa-n
- molecular-weight:
- 217.224
