Difference between revisions of "CPD-11674"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite N-5-PHOSPHORIBOSYL-ANTHRANILATE == * common-name: ** n-(5-phosphoribosyl)-anthranilate * smiles: ** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)nc...")
(Created page with "Category:metabolite == Metabolite CPD-11674 == * common-name: ** 5-hydroxytryptophol sulfate * smiles: ** c(o)cc1(=cnc2(=c1c=c(os(=o)(=o)[o-])c=c2)) * inchi-key: ** focuaj...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite N-5-PHOSPHORIBOSYL-ANTHRANILATE ==
+
== Metabolite CPD-11674 ==
 
* common-name:
 
* common-name:
** n-(5-phosphoribosyl)-anthranilate
+
** 5-hydroxytryptophol sulfate
 
* smiles:
 
* smiles:
** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)nc2(c=cc=cc(c(=o)[o-])=2))
+
** c(o)cc1(=cnc2(=c1c=c(os(=o)(=o)[o-])c=c2))
 
* inchi-key:
 
* inchi-key:
** pmfmjxprnjuymb-gwofurmssa-k
+
** focuajyuoxsnds-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 346.21
+
** 256.253
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PRAISOM-RXN]]
 
* [[PRTRANS-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PRTRANS-RXN]]
+
* [[RXN-10782]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-(5-phosphoribosyl)-anthranilate}}
+
{{#set: common-name=5-hydroxytryptophol sulfate}}
{{#set: inchi-key=inchikey=pmfmjxprnjuymb-gwofurmssa-k}}
+
{{#set: inchi-key=inchikey=focuajyuoxsnds-uhfffaoysa-m}}
{{#set: molecular-weight=346.21}}
+
{{#set: molecular-weight=256.253}}

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-11674

  • common-name:
    • 5-hydroxytryptophol sulfate
  • smiles:
    • c(o)cc1(=cnc2(=c1c=c(os(=o)(=o)[o-])c=c2))
  • inchi-key:
    • focuajyuoxsnds-uhfffaoysa-m
  • molecular-weight:
    • 256.253

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality