Difference between revisions of "CPD-11674"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=NADPH-DEHYDROGENASE-FLAVIN-RXN NADPH-DEHYDROGENASE-FLAVIN-RXN] == * direction: ** left-to-right * e...")
 
(Created page with "Category:metabolite == Metabolite CPD-11674 == * common-name: ** 5-hydroxytryptophol sulfate * smiles: ** c(o)cc1(=cnc2(=c1c=c(os(=o)(=o)[o-])c=c2)) * inchi-key: ** focuaj...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=NADPH-DEHYDROGENASE-FLAVIN-RXN NADPH-DEHYDROGENASE-FLAVIN-RXN] ==
+
== Metabolite CPD-11674 ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** 5-hydroxytryptophol sulfate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.5.1.30 ec-1.5.1.30]
+
** c(o)cc1(=cnc2(=c1c=c(os(=o)(=o)[o-])c=c2))
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[NADPH]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[RIBOFLAVIN]][c] '''=>''' 1 [[CPD-316]][c] '''+''' 1 [[NADP]][c]
+
** focuajyuoxsnds-uhfffaoysa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ09647]]
+
** 256.253
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ16257]]
+
* [[RXN-10782]]
−
** Category: [[orthology]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: common-name=5-hydroxytryptophol sulfate}}
−
* Gene: [[SJ17624]]
+
{{#set: inchi-key=inchikey=focuajyuoxsnds-uhfffaoysa-m}}
−
** Category: [[orthology]]
+
{{#set: molecular-weight=256.253}}
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
== Pathway(s) ==
 
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=19379 19379]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R05707 R05707]
 
−
* UNIPROT:
 
−
** [http://www.uniprot.org/uniprot/P30043 P30043]
 
−
** [http://www.uniprot.org/uniprot/P52556 P52556]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: ec-number=ec-1.5.1.30}}
 
−
{{#set: nb gene associated=3}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-11674

  • common-name:
    • 5-hydroxytryptophol sulfate
  • smiles:
    • c(o)cc1(=cnc2(=c1c=c(os(=o)(=o)[o-])c=c2))
  • inchi-key:
    • focuajyuoxsnds-uhfffaoysa-m
  • molecular-weight:
    • 256.253

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-11674&oldid=139219"