Difference between revisions of "CPD-11674"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=NADPH-DEHYDROGENASE-FLAVIN-RXN NADPH-DEHYDROGENASE-FLAVIN-RXN] == * direction: ** left-to-right * e...") |
(Created page with "Category:metabolite == Metabolite CPD-11674 == * common-name: ** 5-hydroxytryptophol sulfate * smiles: ** c(o)cc1(=cnc2(=c1c=c(os(=o)(=o)[o-])c=c2)) * inchi-key: ** focuaj...") |
||
(9 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-11674 == |
− | * | + | * common-name: |
− | ** | + | ** 5-hydroxytryptophol sulfate |
− | * | + | * smiles: |
− | ** | + | ** c(o)cc1(=cnc2(=c1c=c(os(=o)(=o)[o-])c=c2)) |
− | == | + | * inchi-key: |
− | + | ** focuajyuoxsnds-uhfffaoysa-m | |
− | = | + | * molecular-weight: |
− | * | + | ** 256.253 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | * | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-10782]] | |
− | ** | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=5-hydroxytryptophol sulfate}} | |
− | + | {{#set: inchi-key=inchikey=focuajyuoxsnds-uhfffaoysa-m}} | |
− | + | {{#set: molecular-weight=256.253}} | |
− | |||
− | == | ||
− | == | ||
− | * | ||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-11674
- common-name:
- 5-hydroxytryptophol sulfate
- smiles:
- c(o)cc1(=cnc2(=c1c=c(os(=o)(=o)[o-])c=c2))
- inchi-key:
- focuajyuoxsnds-uhfffaoysa-m
- molecular-weight:
- 256.253