Difference between revisions of "CPD-11674"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10038 RXN-10038] == * direction: ** reversible * common-name: ** o-phosphoseryl-trna[ser]sec ki...")
(Created page with "Category:metabolite == Metabolite CPD-11937 == * common-name: ** 1d-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate * smiles: ** c1(op([o-])(=o)[o-])(c(op([o-])(=o)...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10038 RXN-10038] ==
+
== Metabolite CPD-11937 ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** o-phosphoseryl-trna[ser]sec kinase
+
** 1d-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.7.1.164 ec-2.7.1.164]
+
** c1(op([o-])(=o)[o-])(c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])op(o)(=o)[o-])c(op([o-])([o-])=o)c(op([o-])([o-])=o)1)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[ATP]][c] '''+''' 1 [[L-seryl-SEC-tRNAs]][c] '''<=>''' 1 [[ADP]][c] '''+''' 1 [[O-phospho-L-seryl-tRNASecs]][c] '''+''' 1 [[PROTON]][c]
+
** uphpwxpnziozjl-ptqmnwpwsa-b
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ19400]]
+
** 727.921
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-10973]]
−
== Pathway(s) ==
+
* [[RXN-10976]]
−
* [[PWY-6281]], L-selenocysteine biosynthesis II (archaea and eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6281 PWY-6281]
+
* [[RXN-10978]]
−
** '''4''' reactions found over '''4''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
== Reconstruction information  ==
+
* [[RXN-10971]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-10976]]
−
== External links  ==
+
* [[RXN-10978]]
−
* RHEA:
+
== Reaction(s) of unknown directionality ==
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25040 25040]
+
{{#set: common-name=1d-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate}}
−
* LIGAND-RXN:
+
{{#set: inchi-key=inchikey=uphpwxpnziozjl-ptqmnwpwsa-b}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R08223 R08223]
+
{{#set: molecular-weight=727.921}}
−
{{#set: direction=reversible}}
 
−
{{#set: common-name=o-phosphoseryl-trna[ser]sec kinase}}
 
−
{{#set: ec-number=ec-2.7.1.164}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:36, 18 December 2020

Metabolite CPD-11937

  • common-name:
    • 1d-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate
  • smiles:
    • c1(op([o-])(=o)[o-])(c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])op(o)(=o)[o-])c(op([o-])([o-])=o)c(op([o-])([o-])=o)1)
  • inchi-key:
    • uphpwxpnziozjl-ptqmnwpwsa-b
  • molecular-weight:
    • 727.921

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-11674&oldid=48035"