Difference between revisions of "CPD-11690"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Arachidoyl-ACPs == * common-name: ** an arachidoyl-[acp] == Reaction(s) known to consume the compound == * RXN1G-445 == Reaction(s) k...") |
(Created page with "Category:metabolite == Metabolite CPD-11690 == * common-name: ** 1-oleoyl-sn-glycerol * smiles: ** ccccccccc=ccccccccc(=o)occ(co)o * inchi-key: ** rzrnayuhwvfmip-qjrazlaks...") |
||
(3 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-11690 == |
* common-name: | * common-name: | ||
− | ** | + | ** 1-oleoyl-sn-glycerol |
+ | * smiles: | ||
+ | ** ccccccccc=ccccccccc(=o)occ(co)o | ||
+ | * inchi-key: | ||
+ | ** rzrnayuhwvfmip-qjrazlaksa-n | ||
+ | * molecular-weight: | ||
+ | ** 356.545 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-15089]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=1-oleoyl-sn-glycerol}} |
+ | {{#set: inchi-key=inchikey=rzrnayuhwvfmip-qjrazlaksa-n}} | ||
+ | {{#set: molecular-weight=356.545}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-11690
- common-name:
- 1-oleoyl-sn-glycerol
- smiles:
- ccccccccc=ccccccccc(=o)occ(co)o
- inchi-key:
- rzrnayuhwvfmip-qjrazlaksa-n
- molecular-weight:
- 356.545