Difference between revisions of "CPD-11690"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=I5NT I5NT] == * direction: ** left-to-right * common-name: ** imp-5'-nucleotidase == Reaction formu...") |
(Created page with "Category:metabolite == Metabolite CPD-11690 == * common-name: ** 1-oleoyl-sn-glycerol * smiles: ** ccccccccc=ccccccccc(=o)occ(co)o * inchi-key: ** rzrnayuhwvfmip-qjrazlaks...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-11690 == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** 1-oleoyl-sn-glycerol |
| − | + | * smiles: | |
| − | * | + | ** ccccccccc=ccccccccc(=o)occ(co)o |
| − | = | + | * inchi-key: |
| − | * | + | ** rzrnayuhwvfmip-qjrazlaksa-n |
| − | ** | + | * molecular-weight: |
| − | ** | + | ** 356.545 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-15089]] | |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=1-oleoyl-sn-glycerol}} | |
| − | {{#set: common-name= | + | {{#set: inchi-key=inchikey=rzrnayuhwvfmip-qjrazlaksa-n}} |
| − | {{#set: | + | {{#set: molecular-weight=356.545}} |
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-11690
- common-name:
- 1-oleoyl-sn-glycerol
- smiles:
- ccccccccc=ccccccccc(=o)occ(co)o
- inchi-key:
- rzrnayuhwvfmip-qjrazlaksa-n
- molecular-weight:
- 356.545
