Difference between revisions of "CPD-11690"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8001 RXN-8001] == * direction: ** left-to-right * common-name: ** histidinol dehydrogenase * ec...")
(Created page with "Category:metabolite == Metabolite CMP == * common-name: ** cmp * smiles: ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op([o-])([o-])=o * inchi-key: ** ierhlvcpsmictf-xvfcmesi...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8001 RXN-8001] ==
+
== Metabolite CMP ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** histidinol dehydrogenase
+
** cmp
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.1.1.23 ec-1.1.1.23]
+
** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op([o-])([o-])=o
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[HISTIDINOL]][c] '''+''' 2 [[NAD]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[HIS]][c] '''+''' 2 [[NADH]][c] '''+''' 3 [[PROTON]][c]
+
** ierhlvcpsmictf-xvfcmesisa-l
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ10107]]
+
** 321.183
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[ATCM]]
−
* Gene: [[SJ18961]]
+
* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
−
** Category: [[annotation]]
+
* [[CERAMIDE-CHOLINEPHOSPHOTRANSFERASE-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[PHOSPHASERSYN-RXN]]
−
** Category: [[orthology]]
+
* [[RXN-11832]]
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-14026]]
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-5781]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-9614]]
−
* Gene: [[SJ07444]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[2.7.8.11-RXN]]
−
== Pathway(s)  ==
+
* [[ATCY]]
−
== Reconstruction information  ==
+
* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[CERAMIDE-CHOLINEPHOSPHOTRANSFERASE-RXN]]
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[DATCY]]
−
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
* [[DCTCP]]
−
== External links  ==
+
* [[DGTCY]]
−
* RHEA:
+
* [[DTTGY]]
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20641 20641]
+
* [[DUTCP]]
−
* LIGAND-RXN:
+
* [[ETHANOLAMINEPHOSPHOTRANSFERASE-RXN]]
−
** [http://www.genome.jp/dbget-bin/www_bget?R01158 R01158]
+
* [[GTCY]]
−
{{#set: direction=left-to-right}}
+
* [[ITCY]]
−
{{#set: common-name=histidinol dehydrogenase}}
+
* [[P-PANTOCYSLIG-RXN]]
−
{{#set: ec-number=ec-1.1.1.23}}
+
* [[PHOSPHAGLYPSYN-RXN]]
−
{{#set: nb gene associated=3}}
+
* [[PHOSPHASERSYN-RXN]]
−
{{#set: nb pathway associated=0}}
+
* [[RXN-12198]]
−
{{#set: reconstruction category=annotation|orthology}}
+
* [[RXN-12200]]
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+
* [[RXN-17731]]
−
{{#set: reconstruction comment=n.a}}
+
* [[RXN-17733]]
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome|output_pantograph_nannochloropsis_salina}}
+
* [[RXN-5781]]
 +
* [[RXN-8141]]
 +
* [[RXN-9614]]
 +
* [[RXN0-302]]
 +
* [[RXN0-383]]
 +
* [[RXN66-578]]
 +
* [[UTCY]]
 +
</div>
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=cmp}}
 +
{{#set: inchi-key=inchikey=ierhlvcpsmictf-xvfcmesisa-l}}
 +
{{#set: molecular-weight=321.183}}

Revision as of 20:36, 18 December 2020

Metabolite CMP

  • common-name:
    • cmp
  • smiles:
    • c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op([o-])([o-])=o
  • inchi-key:
    • ierhlvcpsmictf-xvfcmesisa-l
  • molecular-weight:
    • 321.183

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-11690&oldid=47965"