Difference between revisions of "CPD-11700"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P == * common-name: ** 1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate * smiles: ** c(op(=o)([o-]...")
(Created page with "Category:metabolite == Metabolite CPD-17272 == * common-name: ** 1-oleoyl-2-palmitoyl-glycerol * smiles: ** ccccccccc=ccccccccc(occ(oc(=o)ccccccccccccccc)co)=o * inchi-key...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P ==
+
== Metabolite CPD-17272 ==
 
* common-name:
 
* common-name:
** 1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate
+
** 1-oleoyl-2-palmitoyl-glycerol
 
* smiles:
 
* smiles:
** c(op(=o)([o-])[o-])c(o)c(o)c(=o)cnc1(c=cc=cc(c(=o)[o-])=1)
+
** ccccccccc=ccccccccc(occ(oc(=o)ccccccccccccccc)co)=o
 
* inchi-key:
 
* inchi-key:
** qkmbynrmprkvto-mnovxskesa-k
+
** dozkmfvmcatmeh-ozktzcccsa-n
 
* molecular-weight:
 
* molecular-weight:
** 346.21
+
** 594.957
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[IGPSYN-RXN]]
+
* [[RXN-16027]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PRAISOM-RXN]]
+
* [[RXN-16027]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate}}
+
{{#set: common-name=1-oleoyl-2-palmitoyl-glycerol}}
{{#set: inchi-key=inchikey=qkmbynrmprkvto-mnovxskesa-k}}
+
{{#set: inchi-key=inchikey=dozkmfvmcatmeh-ozktzcccsa-n}}
{{#set: molecular-weight=346.21}}
+
{{#set: molecular-weight=594.957}}

Revision as of 08:31, 15 March 2021

Metabolite CPD-17272

  • common-name:
    • 1-oleoyl-2-palmitoyl-glycerol
  • smiles:
    • ccccccccc=ccccccccc(occ(oc(=o)ccccccccccccccc)co)=o
  • inchi-key:
    • dozkmfvmcatmeh-ozktzcccsa-n
  • molecular-weight:
    • 594.957

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality