Difference between revisions of "CPD-11700"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17272 == * common-name: ** 1-oleoyl-2-palmitoyl-glycerol * smiles: ** ccccccccc=ccccccccc(occ(oc(=o)ccccccccccccccc)co)=o * inchi-key...")
(Created page with "Category:metabolite == Metabolite CPD-11700 == * common-name: ** 1d-myo-inositol 1-diphosphate 2,3,4,5,6-pentakisphosphate * smiles: ** c1(op(=o)([o-])[o-])(c(op([o-])(=o)...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17272 ==
+
== Metabolite CPD-11700 ==
 
* common-name:
 
* common-name:
** 1-oleoyl-2-palmitoyl-glycerol
+
** 1d-myo-inositol 1-diphosphate 2,3,4,5,6-pentakisphosphate
 
* smiles:
 
* smiles:
** ccccccccc=ccccccccc(occ(oc(=o)ccccccccccccccc)co)=o
+
** c1(op(=o)([o-])[o-])(c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(op([o-])(=o)[o-])([o-])=o)c(op([o-])([o-])=o)c(op(=o)([o-])[o-])1)
 
* inchi-key:
 
* inchi-key:
** dozkmfvmcatmeh-ozktzcccsa-n
+
** uphpwxpnziozjl-uotptpdrsa-a
 
* molecular-weight:
 
* molecular-weight:
** 594.957
+
** 726.913
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16027]]
+
* [[RXN-10974]]
 +
* [[RXN-10975]]
 +
* [[RXN-10977]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16027]]
+
* [[RXN-10972]]
 +
* [[RXN-10975]]
 +
* [[RXN-10977]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-oleoyl-2-palmitoyl-glycerol}}
+
{{#set: common-name=1d-myo-inositol 1-diphosphate 2,3,4,5,6-pentakisphosphate}}
{{#set: inchi-key=inchikey=dozkmfvmcatmeh-ozktzcccsa-n}}
+
{{#set: inchi-key=inchikey=uphpwxpnziozjl-uotptpdrsa-a}}
{{#set: molecular-weight=594.957}}
+
{{#set: molecular-weight=726.913}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-11700

  • common-name:
    • 1d-myo-inositol 1-diphosphate 2,3,4,5,6-pentakisphosphate
  • smiles:
    • c1(op(=o)([o-])[o-])(c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(op([o-])(=o)[o-])([o-])=o)c(op([o-])([o-])=o)c(op(=o)([o-])[o-])1)
  • inchi-key:
    • uphpwxpnziozjl-uotptpdrsa-a
  • molecular-weight:
    • 726.913

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality