Difference between revisions of "CPD-11700"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10 RXN-10] == * direction: ** left-to-right * common-name: ** canavaninosuccinate synthetase *...")
(Created page with "Category:metabolite == Metabolite CPD-11700 == * common-name: ** 1d-myo-inositol 1-diphosphate 2,3,4,5,6-pentakisphosphate * smiles: ** c1(op(=o)([o-])[o-])(c(op([o-])(=o)...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10 RXN-10] ==
+
== Metabolite CPD-11700 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** canavaninosuccinate synthetase
+
** 1d-myo-inositol 1-diphosphate 2,3,4,5,6-pentakisphosphate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/6.3.4.5 ec-6.3.4.5]
+
** c1(op(=o)([o-])[o-])(c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(op([o-])(=o)[o-])([o-])=o)c(op([o-])([o-])=o)c(op(=o)([o-])[o-])1)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[ATP]][c] '''+''' 1 [[L-ASPARTATE]][c] '''+''' 1 [[O-UREIDOHOMOSERINE]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[CANAVANINOSUCCINATE]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[PROTON]][c]
+
** uphpwxpnziozjl-uotptpdrsa-a
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ10377]]
+
** 726.913
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-10974]]
−
** Category: [[orthology]]
+
* [[RXN-10975]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-10977]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
* [[PWY-5]], canavanine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5 PWY-5]
+
* [[RXN-10972]]
−
** '''3''' reactions found over '''4''' reactions in the full pathway
+
* [[RXN-10975]]
−
== Reconstruction information  ==
+
* [[RXN-10977]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: common-name=1d-myo-inositol 1-diphosphate 2,3,4,5,6-pentakisphosphate}}
−
== External links  ==
+
{{#set: inchi-key=inchikey=uphpwxpnziozjl-uotptpdrsa-a}}
−
{{#set: direction=left-to-right}}
+
{{#set: molecular-weight=726.913}}
−
{{#set: common-name=canavaninosuccinate synthetase}}
 
−
{{#set: ec-number=ec-6.3.4.5}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=orthology|annotation}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome|output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-11700

  • common-name:
    • 1d-myo-inositol 1-diphosphate 2,3,4,5,6-pentakisphosphate
  • smiles:
    • c1(op(=o)([o-])[o-])(c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(op([o-])(=o)[o-])([o-])=o)c(op([o-])([o-])=o)c(op(=o)([o-])[o-])1)
  • inchi-key:
    • uphpwxpnziozjl-uotptpdrsa-a
  • molecular-weight:
    • 726.913

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-11700&oldid=139416"