Difference between revisions of "CPD-11700"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 2-Acylglycero-Phosphocholines == * common-name: ** a 2-acyl 1-lyso-phosphatidylcholine == Reaction(s) known to consume the compound == ==...") |
(Created page with "Category:metabolite == Metabolite CPD-11700 == * common-name: ** 1d-myo-inositol 1-diphosphate 2,3,4,5,6-pentakisphosphate * smiles: ** c1(op(=o)([o-])[o-])(c(op([o-])(=o)...") |
||
(6 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-11700 == |
* common-name: | * common-name: | ||
− | ** | + | ** 1d-myo-inositol 1-diphosphate 2,3,4,5,6-pentakisphosphate |
+ | * smiles: | ||
+ | ** c1(op(=o)([o-])[o-])(c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(op([o-])(=o)[o-])([o-])=o)c(op([o-])([o-])=o)c(op(=o)([o-])[o-])1) | ||
+ | * inchi-key: | ||
+ | ** uphpwxpnziozjl-uotptpdrsa-a | ||
+ | * molecular-weight: | ||
+ | ** 726.913 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-10974]] | ||
+ | * [[RXN-10975]] | ||
+ | * [[RXN-10977]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-10972]] |
+ | * [[RXN-10975]] | ||
+ | * [[RXN-10977]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=1d-myo-inositol 1-diphosphate 2,3,4,5,6-pentakisphosphate}} |
+ | {{#set: inchi-key=inchikey=uphpwxpnziozjl-uotptpdrsa-a}} | ||
+ | {{#set: molecular-weight=726.913}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-11700
- common-name:
- 1d-myo-inositol 1-diphosphate 2,3,4,5,6-pentakisphosphate
- smiles:
- c1(op(=o)([o-])[o-])(c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(op([o-])(=o)[o-])([o-])=o)c(op([o-])([o-])=o)c(op(=o)([o-])[o-])1)
- inchi-key:
- uphpwxpnziozjl-uotptpdrsa-a
- molecular-weight:
- 726.913