Difference between revisions of "CPD-11700"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13449 RXN-13449] == * direction: ** left-to-right * common-name: ** short-chain acyl-coa dehydr...") |
(Created page with "Category:metabolite == Metabolite CPD-11700 == * common-name: ** 1d-myo-inositol 1-diphosphate 2,3,4,5,6-pentakisphosphate * smiles: ** c1(op(=o)([o-])[o-])(c(op([o-])(=o)...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-11700 == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** 1d-myo-inositol 1-diphosphate 2,3,4,5,6-pentakisphosphate |
− | * | + | * smiles: |
− | ** [ | + | ** c1(op(=o)([o-])[o-])(c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(op([o-])(=o)[o-])([o-])=o)c(op([o-])([o-])=o)c(op(=o)([o-])[o-])1) |
− | + | * inchi-key: | |
− | + | ** uphpwxpnziozjl-uotptpdrsa-a | |
− | == | + | * molecular-weight: |
− | * | + | ** 726.913 |
− | * | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-10974]] |
− | == | + | * [[RXN-10975]] |
− | + | * [[RXN-10977]] | |
− | * | + | == Reaction(s) known to produce the compound == |
− | == | + | * [[RXN-10972]] |
− | + | * [[RXN-10975]] | |
− | + | * [[RXN-10977]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | {{#set: common-name= | + | {{#set: common-name=1d-myo-inositol 1-diphosphate 2,3,4,5,6-pentakisphosphate}} |
− | + | {{#set: inchi-key=inchikey=uphpwxpnziozjl-uotptpdrsa-a}} | |
− | {{#set: | + | {{#set: molecular-weight=726.913}} |
− | |||
− | |||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-11700
- common-name:
- 1d-myo-inositol 1-diphosphate 2,3,4,5,6-pentakisphosphate
- smiles:
- c1(op(=o)([o-])[o-])(c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(op([o-])(=o)[o-])([o-])=o)c(op([o-])([o-])=o)c(op(=o)([o-])[o-])1)
- inchi-key:
- uphpwxpnziozjl-uotptpdrsa-a
- molecular-weight:
- 726.913