Difference between revisions of "CPD-11715"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7100 == * common-name: ** (2s)-2-isopropyl-3-oxosuccinate * smiles: ** cc(c(c(=o)[o-])c(=o)c(=o)[o-])c * inchi-key: ** hiizagqwabamrr...") |
(Created page with "Category:metabolite == Metabolite Charged-MET-tRNAs == * common-name: ** an l-methionyl-[elongator trnamet] == Reaction(s) known to consume the compound == == Reaction(s)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Charged-MET-tRNAs == |
* common-name: | * common-name: | ||
| − | ** | + | ** an l-methionyl-[elongator trnamet] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[METHIONINE--TRNA-LIGASE-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an l-methionyl-[elongator trnamet]}} |
| − | |||
| − | |||
Revision as of 08:24, 15 March 2021
Contents
Metabolite Charged-MET-tRNAs
- common-name:
- an l-methionyl-[elongator trnamet]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an l-methionyl-[elongator trnamet" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
