Difference between revisions of "CPD-11770"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Charged-SER-tRNAs == * common-name: ** an l-seryl-[trnaser] == Reaction(s) known to consume the compound == == Reaction(s) known to produ...")
(Created page with "Category:metabolite == Metabolite CPD-14795 == * common-name: ** udp-n-acetyl-α-d-galactosamine * smiles: ** cc(nc3(c(op(op(occ1(c(c(c(o1)n2(c=cc(nc2=o)=o))o)o))([o-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Charged-SER-tRNAs ==
+
== Metabolite CPD-14795 ==
 
* common-name:
 
* common-name:
** an l-seryl-[trnaser]
+
** udp-n-acetyl-α-d-galactosamine
 +
* smiles:
 +
** cc(nc3(c(op(op(occ1(c(c(c(o1)n2(c=cc(nc2=o)=o))o)o))([o-])=o)([o-])=o)oc(c(c3o)o)co))=o
 +
* inchi-key:
 +
** lftytuazoprmmi-nessujcysa-l
 +
* molecular-weight:
 +
** 605.342
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-13760]]
 +
* [[RXN-14841]]
 +
* [[UDP-N-ACETYLGLUCOSAMINE-4-EPIMERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[SERINE--TRNA-LIGASE-RXN]]
+
* [[RXN-13760]]
 +
* [[RXN-14841]]
 +
* [[UDP-N-ACETYLGLUCOSAMINE-4-EPIMERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an l-seryl-[trnaser]}}
+
{{#set: common-name=udp-n-acetyl-α-d-galactosamine}}
 +
{{#set: inchi-key=inchikey=lftytuazoprmmi-nessujcysa-l}}
 +
{{#set: molecular-weight=605.342}}

Revision as of 18:57, 14 January 2021

Metabolite CPD-14795

  • common-name:
    • udp-n-acetyl-α-d-galactosamine
  • smiles:
    • cc(nc3(c(op(op(occ1(c(c(c(o1)n2(c=cc(nc2=o)=o))o)o))([o-])=o)([o-])=o)oc(c(c3o)o)co))=o
  • inchi-key:
    • lftytuazoprmmi-nessujcysa-l
  • molecular-weight:
    • 605.342

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality