Difference between revisions of "CPD-11770"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN0-460 TRANS-RXN0-460] == * direction: ** reversible == Reaction formula == * 1 UREA[c]...") |
(Created page with "Category:metabolite == Metabolite CPD-11770 == * common-name: ** 7,8-dihydromonapterin * smiles: ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)co)=2)) * inchi-key: ** yqifamynggotfb...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-11770 == |
| − | * | + | * common-name: |
| − | ** | + | ** 7,8-dihydromonapterin |
| − | + | * smiles: | |
| − | * | + | ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)co)=2)) |
| − | = | + | * inchi-key: |
| − | * | + | ** yqifamynggotfb-njgyiypdsa-n |
| − | ** | + | * molecular-weight: |
| − | * | + | ** 255.233 |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | == | + | * [[RXN-10857]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | == | + | {{#set: common-name=7,8-dihydromonapterin}} |
| − | + | {{#set: inchi-key=inchikey=yqifamynggotfb-njgyiypdsa-n}} | |
| − | + | {{#set: molecular-weight=255.233}} | |
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-11770
- common-name:
- 7,8-dihydromonapterin
- smiles:
- c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)co)=2))
- inchi-key:
- yqifamynggotfb-njgyiypdsa-n
- molecular-weight:
- 255.233
