Difference between revisions of "CPD-11855"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 25S-rRNA-adenine-645 == * common-name: ** adenine645 in 25s rrna == Reaction(s) known to consume the compound == * RXN-14550 == React...") |
(Created page with "Category:metabolite == Metabolite CPD-11855 == * common-name: ** (r)-4-hydroxy-4-methyl-2-oxoglutarate * smiles: ** cc(o)(cc(c(=o)[o-])=o)c([o-])=o * inchi-key: ** yrwamsx...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-11855 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (r)-4-hydroxy-4-methyl-2-oxoglutarate |
| + | * smiles: | ||
| + | ** cc(o)(cc(c(=o)[o-])=o)c([o-])=o | ||
| + | * inchi-key: | ||
| + | ** yrwamsxhybbhfl-zcfiwibfsa-l | ||
| + | * molecular-weight: | ||
| + | ** 174.11 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-12074]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-12074]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(r)-4-hydroxy-4-methyl-2-oxoglutarate}} |
| + | {{#set: inchi-key=inchikey=yrwamsxhybbhfl-zcfiwibfsa-l}} | ||
| + | {{#set: molecular-weight=174.11}} | ||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-11855
- common-name:
- (r)-4-hydroxy-4-methyl-2-oxoglutarate
- smiles:
- cc(o)(cc(c(=o)[o-])=o)c([o-])=o
- inchi-key:
- yrwamsxhybbhfl-zcfiwibfsa-l
- molecular-weight:
- 174.11
