Difference between revisions of "CPD-11877"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9366 RXN-9366] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/2....")
(Created page with "Category:metabolite == Metabolite CPD-11877 == * common-name: ** metanephrine * smiles: ** c[n+]cc(o)c1(c=cc(o)=c(oc)c=1) * inchi-key: ** jwjctzkfygdabj-vifpvbqesa-o * mol...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9366 RXN-9366] ==
+
== Metabolite CPD-11877 ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** metanephrine
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.1.1.163 ec-2.1.1.163]
+
** c[n+]cc(o)c1(c=cc(o)=c(oc)c=1)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-12122]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[CPD-12130]][c] '''+''' 1 [[PROTON]][c]
+
** jwjctzkfygdabj-vifpvbqesa-o
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ02842]]
+
** 198.241
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-10913]]
−
* Gene: [[SJ07072]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: common-name=metanephrine}}
−
* Gene: [[SJ02693]]
+
{{#set: inchi-key=inchikey=jwjctzkfygdabj-vifpvbqesa-o}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=198.241}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
* Gene: [[SJ00609]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
* Gene: [[SJ11757]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
* Gene: [[SJ20751]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
== Pathway(s) ==
 
−
* [[PWY-5895]], menaquinol-13 biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5895 PWY-5895]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=44797 44797]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: ec-number=ec-2.1.1.163}}
 
−
{{#set: nb gene associated=6}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-11877

  • common-name:
    • metanephrine
  • smiles:
    • c[n+]cc(o)c1(c=cc(o)=c(oc)c=1)
  • inchi-key:
    • jwjctzkfygdabj-vifpvbqesa-o
  • molecular-weight:
    • 198.241

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-11877&oldid=139675"