Difference between revisions of "CPD-11877"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Quinones == * common-name: ** a quinone == Reaction(s) known to consume the compound == * QOR-RXN == Reaction(s) known to produce the...") |
(Created page with "Category:metabolite == Metabolite CPD-11877 == * common-name: ** metanephrine * smiles: ** c[n+]cc(o)c1(c=cc(o)=c(oc)c=1) * inchi-key: ** jwjctzkfygdabj-vifpvbqesa-o * mol...") |
||
| (6 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-11877 == |
* common-name: | * common-name: | ||
| − | ** | + | ** metanephrine |
| + | * smiles: | ||
| + | ** c[n+]cc(o)c1(c=cc(o)=c(oc)c=1) | ||
| + | * inchi-key: | ||
| + | ** jwjctzkfygdabj-vifpvbqesa-o | ||
| + | * molecular-weight: | ||
| + | ** 198.241 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-10913]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=metanephrine}} |
| + | {{#set: inchi-key=inchikey=jwjctzkfygdabj-vifpvbqesa-o}} | ||
| + | {{#set: molecular-weight=198.241}} | ||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-11877
- common-name:
- metanephrine
- smiles:
- c[n+]cc(o)c1(c=cc(o)=c(oc)c=1)
- inchi-key:
- jwjctzkfygdabj-vifpvbqesa-o
- molecular-weight:
- 198.241
