Difference between revisions of "CPD-11877"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite BETAINE == * common-name: ** glycine betaine * smiles: ** c[n+](c)(cc([o-])=o)c * inchi-key: ** kwiuhfftvrnatp-uhfffaoysa-n * molecular-w...")
(Created page with "Category:metabolite == Metabolite CPD0-341 == * common-name: ** s-succinyl-dihydrolipoamide * smiles: ** c(n)(=o)ccccc(sc(=o)ccc(=o)[o-])ccs * inchi-key: ** rjcjwoncskshes...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite BETAINE ==
+
== Metabolite CPD0-341 ==
 
* common-name:
 
* common-name:
** glycine betaine
+
** s-succinyl-dihydrolipoamide
 
* smiles:
 
* smiles:
** c[n+](c)(cc([o-])=o)c
+
** c(n)(=o)ccccc(sc(=o)ccc(=o)[o-])ccs
 
* inchi-key:
 
* inchi-key:
** kwiuhfftvrnatp-uhfffaoysa-n
+
** rjcjwoncskshes-vifpvbqesa-m
 
* molecular-weight:
 
* molecular-weight:
** 117.147
+
** 306.414
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.1.1.5-RXN]]
+
* [[AKGDHe2r]]
* [[BADH-RXN]]
 
* [[RXN-4181-CPD-4101/DIMETHYL-GLYCINE//EPISTEROL/BETAINE.45.]]
 
* [[RXN-4208-CPD-4124/DIMETHYL-GLYCINE//CPD-4125/BETAINE.44.]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[BADH-RXN]]
+
* [[AKGDHe2r]]
* [[RXN-13405]]
+
* [[AKGDHmi]]
* [[RXN-13406]]
 
* [[RXN-4181-CPD-4101/DIMETHYL-GLYCINE//EPISTEROL/BETAINE.45.]]
 
* [[RXN-4208-CPD-4124/DIMETHYL-GLYCINE//CPD-4125/BETAINE.44.]]
 
* [[RXN-9680]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=glycine betaine}}
+
{{#set: common-name=s-succinyl-dihydrolipoamide}}
{{#set: inchi-key=inchikey=kwiuhfftvrnatp-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=rjcjwoncskshes-vifpvbqesa-m}}
{{#set: molecular-weight=117.147}}
+
{{#set: molecular-weight=306.414}}

Revision as of 15:30, 5 January 2021

Metabolite CPD0-341

  • common-name:
    • s-succinyl-dihydrolipoamide
  • smiles:
    • c(n)(=o)ccccc(sc(=o)ccc(=o)[o-])ccs
  • inchi-key:
    • rjcjwoncskshes-vifpvbqesa-m
  • molecular-weight:
    • 306.414

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality