Difference between revisions of "CPD-11877"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ARGDECARBOX-RXN ARGDECARBOX-RXN] == * direction: ** reversible * common-name: ** arginine decarboxy...")
(Created page with "Category:metabolite == Metabolite CPD-11877 == * common-name: ** metanephrine * smiles: ** c[n+]cc(o)c1(c=cc(o)=c(oc)c=1) * inchi-key: ** jwjctzkfygdabj-vifpvbqesa-o * mol...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ARGDECARBOX-RXN ARGDECARBOX-RXN] ==
+
== Metabolite CPD-11877 ==
* direction:
 
** reversible
 
 
* common-name:
 
* common-name:
** arginine decarboxylase, biosynthetic
+
** metanephrine
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/4.1.1.19 ec-4.1.1.19]
+
** c[n+]cc(o)c1(c=cc(o)=c(oc)c=1)
== Reaction formula ==
+
* inchi-key:
* 1 [[ARG]][c] '''+''' 1 [[PROTON]][c] '''<=>''' 1 [[AGMATHINE]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
+
** jwjctzkfygdabj-vifpvbqesa-o
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ12405]]
+
** 198.241
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-10913]]
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
* [[PWY-6305]], putrescine biosynthesis IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6305 PWY-6305]
+
== Reaction(s) of unknown directionality ==
** '''4''' reactions found over '''4''' reactions in the full pathway
+
{{#set: common-name=metanephrine}}
* [[PWY0-1299]], arginine dependent acid resistance: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1299 PWY0-1299]
+
{{#set: inchi-key=inchikey=jwjctzkfygdabj-vifpvbqesa-o}}
** '''1''' reactions found over '''1''' reactions in the full pathway
+
{{#set: molecular-weight=198.241}}
* [[PWY-40]], putrescine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-40 PWY-40]
 
** '''2''' reactions found over '''2''' reactions in the full pathway
 
* [[PWY-6834]], spermidine biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6834 PWY-6834]
 
** '''2''' reactions found over '''4''' reactions in the full pathway
 
* [[ARGDEG-III-PWY]], L-arginine degradation IV (arginine decarboxylase/agmatine deiminase pathway): [http://metacyc.org/META/NEW-IMAGE?object=ARGDEG-III-PWY ARGDEG-III-PWY]
 
** '''3''' reactions found over '''3''' reactions in the full pathway
 
* [[PWY0-823]], L-arginine degradation III (arginine decarboxylase/agmatinase pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY0-823 PWY0-823]
 
** '''2''' reactions found over '''2''' reactions in the full pathway
 
* [[PWY-43]], putrescine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-43 PWY-43]
 
** '''3''' reactions found over '''3''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== External links  ==
 
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=17644 17644]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R00566 R00566]
 
* UNIPROT:
 
** [http://www.uniprot.org/uniprot/P21170 P21170]
 
** [http://www.uniprot.org/uniprot/Q9PPF5 Q9PPF5]
 
** [http://www.uniprot.org/uniprot/Q9JT25 Q9JT25]
 
** [http://www.uniprot.org/uniprot/P49726 P49726]
 
** [http://www.uniprot.org/uniprot/P22220 P22220]
 
** [http://www.uniprot.org/uniprot/P28629 P28629]
 
** [http://www.uniprot.org/uniprot/Q43075 Q43075]
 
** [http://www.uniprot.org/uniprot/Q9SI64 Q9SI64]
 
** [http://www.uniprot.org/uniprot/P72587 P72587]
 
** [http://www.uniprot.org/uniprot/P74576 P74576]
 
** [http://www.uniprot.org/uniprot/O24128 O24128]
 
** [http://www.uniprot.org/uniprot/O23141 O23141]
 
** [http://www.uniprot.org/uniprot/Q39827 Q39827]
 
** [http://www.uniprot.org/uniprot/O81161 O81161]
 
** [http://www.uniprot.org/uniprot/O04429 O04429]
 
** [http://www.uniprot.org/uniprot/Q96412 Q96412]
 
** [http://www.uniprot.org/uniprot/O81177 O81177]
 
** [http://www.uniprot.org/uniprot/O64453 O64453]
 
</div>
 
{{#set: direction=reversible}}
 
{{#set: common-name=arginine decarboxylase, biosynthetic}}
 
{{#set: ec-number=ec-4.1.1.19}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=7}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-11877

  • common-name:
    • metanephrine
  • smiles:
    • c[n+]cc(o)c1(c=cc(o)=c(oc)c=1)
  • inchi-key:
    • jwjctzkfygdabj-vifpvbqesa-o
  • molecular-weight:
    • 198.241

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality