Difference between revisions of "CPD-11878"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5131 RXN0-5131] == * direction: ** reversible * ec-number: ** [http://enzyme.expasy.org/EC/2.7...")
(Created page with "Category:metabolite == Metabolite CPD-11878 == * common-name: ** 3,4-dihydroxyphenylglycol * smiles: ** c(o)c(o)c1(c=cc(o)=c(o)c=1) * inchi-key: ** mtvwfvdwrvydor-qmmmgpob...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5131 RXN0-5131] ==
+
== Metabolite CPD-11878 ==
−
* direction:
+
* common-name:
−
** reversible
+
** 3,4-dihydroxyphenylglycol
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.7.7 ec-2.7.7]
+
** c(o)c(o)c1(c=cc(o)=c(o)c=1)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[IS30-Insertion-Sequences]][c] '''<=>''' 1 [[IS30-with-Integrated-Transposon]][c]
+
** mtvwfvdwrvydor-qmmmgpobsa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ21731]]
+
** 170.165
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ05212]]
+
* [[RXN-10911]]
−
** Category: [[orthology]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: common-name=3,4-dihydroxyphenylglycol}}
−
== Pathway(s) ==
+
{{#set: inchi-key=inchikey=mtvwfvdwrvydor-qmmmgpobsa-n}}
−
== Reconstruction information  ==
+
{{#set: molecular-weight=170.165}}
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=reversible}}
 
−
{{#set: ec-number=ec-2.7.7}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-11878

  • common-name:
    • 3,4-dihydroxyphenylglycol
  • smiles:
    • c(o)c(o)c1(c=cc(o)=c(o)c=1)
  • inchi-key:
    • mtvwfvdwrvydor-qmmmgpobsa-n
  • molecular-weight:
    • 170.165

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-11878&oldid=138760"