Difference between revisions of "CPD-11878"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R145-RXN R145-RXN] == * direction: ** left-to-right * common-name: ** methylthioribulose 1-phosphat...")
 
(Created page with "Category:metabolite == Metabolite CPD-11878 == * common-name: ** 3,4-dihydroxyphenylglycol * smiles: ** c(o)c(o)c1(c=cc(o)=c(o)c=1) * inchi-key: ** mtvwfvdwrvydor-qmmmgpob...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=R145-RXN R145-RXN] ==
+
== Metabolite CPD-11878 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** methylthioribulose 1-phosphate dehydratase
+
** 3,4-dihydroxyphenylglycol
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/4.2.1.109 ec-4.2.1.109]
+
** c(o)c(o)c1(c=cc(o)=c(o)c=1)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-1063]][c] '''=>''' 1 [[CPD-8999]][c] '''+''' 1 [[WATER]][c]
+
** mtvwfvdwrvydor-qmmmgpobsa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ17981]]
+
** 170.165
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) ==
+
* [[RXN-10911]]
−
* [[PWY-4361]], S-methyl-5-thio-α-D-ribose 1-phosphate degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4361 PWY-4361]
+
== Reaction(s) of unknown directionality ==
−
** '''3''' reactions found over '''7''' reactions in the full pathway
+
{{#set: common-name=3,4-dihydroxyphenylglycol}}
−
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=mtvwfvdwrvydor-qmmmgpobsa-n}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=170.165}}
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15550 15550]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R07392 R07392]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=methylthioribulose 1-phosphate dehydratase}}
 
−
{{#set: ec-number=ec-4.2.1.109}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-11878

  • common-name:
    • 3,4-dihydroxyphenylglycol
  • smiles:
    • c(o)c(o)c1(c=cc(o)=c(o)c=1)
  • inchi-key:
    • mtvwfvdwrvydor-qmmmgpobsa-n
  • molecular-weight:
    • 170.165

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-11878&oldid=138760"