Difference between revisions of "CPD-11878"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13709 RXN-13709] == * direction: ** left-to-right * common-name: ** 4-methylsterol monooxygenas...") |
(Created page with "Category:metabolite == Metabolite CPD66-21 == * common-name: ** leukotriene-d4 * smiles: ** cccccc=ccc=cc=cc=cc(scc(c(=o)ncc([o-])=o)[n+])c(cccc([o-])=o)o * inchi-key: **...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD66-21 == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** leukotriene-d4 |
| − | * | + | * smiles: |
| − | ** | + | ** cccccc=ccc=cc=cc=cc(scc(c(=o)ncc([o-])=o)[n+])c(cccc([o-])=o)o |
| − | == | + | * inchi-key: |
| − | + | ** yeeskjgwjfyook-ijhyuljssa-m | |
| − | == | + | * molecular-weight: |
| − | == | + | ** 495.653 |
| − | + | == Reaction(s) known to consume the compound == | |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | == | + | * [[RXN66-336]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | {{#set: common-name= | + | {{#set: common-name=leukotriene-d4}} |
| − | {{#set: | + | {{#set: inchi-key=inchikey=yeeskjgwjfyook-ijhyuljssa-m}} |
| − | + | {{#set: molecular-weight=495.653}} | |
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
| − | |||
Revision as of 20:35, 18 December 2020
Contents
Metabolite CPD66-21
- common-name:
- leukotriene-d4
- smiles:
- cccccc=ccc=cc=cc=cc(scc(c(=o)ncc([o-])=o)[n+])c(cccc([o-])=o)o
- inchi-key:
- yeeskjgwjfyook-ijhyuljssa-m
- molecular-weight:
- 495.653
