Difference between revisions of "CPD-11879"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CU+2 == * common-name: ** cu2+ * smiles: ** [cu++] * inchi-key: ** jpvynhnxodakfh-uhfffaoysa-n * molecular-weight: ** 63.546 == Reaction(...")
(Created page with "Category:metabolite == Metabolite GLUTACONYL-COA == * common-name: ** (e)-glutaconyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(c=ccc(=o)[o-])=o)cop(=o)(op(=o)(occ1(c(o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CU+2 ==
+
== Metabolite GLUTACONYL-COA ==
 
* common-name:
 
* common-name:
** cu2+
+
** (e)-glutaconyl-coa
 
* smiles:
 
* smiles:
** [cu++]
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(c=ccc(=o)[o-])=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** jpvynhnxodakfh-uhfffaoysa-n
+
** urtlotisfjppou-degqqwijsa-i
 
* molecular-weight:
 
* molecular-weight:
** 63.546
+
** 874.579
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.6.3.4-RXN]]
+
* [[GLUTACONYL-COA-DECARBOXYLASE-RXN]]
* [[Cut1]]
+
* [[GLUTARYL-COA-DEHYDROG-RXN]]
* [[ExchangeSeed-CU+2]]
 
* [[TransportSeed-CU+2]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.6.3.4-RXN]]
+
* [[GLUTACONYL-COA-DECARBOXYLASE-RXN]]
* [[Cut1]]
+
* [[GLUTARYL-COA-DEHYDROG-RXN]]
* [[ExchangeSeed-CU+2]]
 
* [[TransportSeed-CU+2]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cu2+}}
+
{{#set: common-name=(e)-glutaconyl-coa}}
{{#set: inchi-key=inchikey=jpvynhnxodakfh-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=urtlotisfjppou-degqqwijsa-i}}
{{#set: molecular-weight=63.546}}
+
{{#set: molecular-weight=874.579}}

Revision as of 11:13, 15 January 2021

Metabolite GLUTACONYL-COA

  • common-name:
    • (e)-glutaconyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(c=ccc(=o)[o-])=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • urtlotisfjppou-degqqwijsa-i
  • molecular-weight:
    • 874.579

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality