Difference between revisions of "CPD-11879"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GLUTACONYL-COA == * common-name: ** (e)-glutaconyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(c=ccc(=o)[o-])=o)cop(=o)(op(=o)(occ1(c(o...")
(Created page with "Category:metabolite == Metabolite CREATININE == * common-name: ** creatinine * smiles: ** cn1(cc(=o)nc(=n)1) * inchi-key: ** ddrjaanprjihgj-uhfffaoysa-n * molecular-weight...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GLUTACONYL-COA ==
+
== Metabolite CREATININE ==
 
* common-name:
 
* common-name:
** (e)-glutaconyl-coa
+
** creatinine
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(c=ccc(=o)[o-])=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cn1(cc(=o)nc(=n)1)
 
* inchi-key:
 
* inchi-key:
** urtlotisfjppou-degqqwijsa-i
+
** ddrjaanprjihgj-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 874.579
+
** 113.119
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GLUTACONYL-COA-DECARBOXYLASE-RXN]]
+
* [[CREATININASE-RXN]]
* [[GLUTARYL-COA-DEHYDROG-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GLUTACONYL-COA-DECARBOXYLASE-RXN]]
+
* [[CREATININASE-RXN]]
* [[GLUTARYL-COA-DEHYDROG-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(e)-glutaconyl-coa}}
+
{{#set: common-name=creatinine}}
{{#set: inchi-key=inchikey=urtlotisfjppou-degqqwijsa-i}}
+
{{#set: inchi-key=inchikey=ddrjaanprjihgj-uhfffaoysa-n}}
{{#set: molecular-weight=874.579}}
+
{{#set: molecular-weight=113.119}}

Revision as of 08:24, 15 March 2021

Metabolite CREATININE

  • common-name:
    • creatinine
  • smiles:
    • cn1(cc(=o)nc(=n)1)
  • inchi-key:
    • ddrjaanprjihgj-uhfffaoysa-n
  • molecular-weight:
    • 113.119

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality