Difference between revisions of "CPD-11879"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CU+2 == * common-name: ** cu2+ * smiles: ** [cu++] * inchi-key: ** jpvynhnxodakfh-uhfffaoysa-n * molecular-weight: ** 63.546 == Reaction(...")
(Created page with "Category:metabolite == Metabolite CPD-11879 == * common-name: ** 3,4-dihydroxymandelate * smiles: ** c(=o)([o-])c(c1(=cc=c(o)c(o)=c1))o * inchi-key: ** rghmisiykihajw-ssdo...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CU+2 ==
+
== Metabolite CPD-11879 ==
 
* common-name:
 
* common-name:
** cu2+
+
** 3,4-dihydroxymandelate
 
* smiles:
 
* smiles:
** [cu++]
+
** c(=o)([o-])c(c1(=cc=c(o)c(o)=c1))o
 
* inchi-key:
 
* inchi-key:
** jpvynhnxodakfh-uhfffaoysa-n
+
** rghmisiykihajw-ssdottswsa-m
 
* molecular-weight:
 
* molecular-weight:
** 63.546
+
** 183.14
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.6.3.4-RXN]]
 
* [[Cut1]]
 
* [[ExchangeSeed-CU+2]]
 
* [[TransportSeed-CU+2]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.6.3.4-RXN]]
+
* [[RXN-10912]]
* [[Cut1]]
 
* [[ExchangeSeed-CU+2]]
 
* [[TransportSeed-CU+2]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cu2+}}
+
{{#set: common-name=3,4-dihydroxymandelate}}
{{#set: inchi-key=inchikey=jpvynhnxodakfh-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=rghmisiykihajw-ssdottswsa-m}}
{{#set: molecular-weight=63.546}}
+
{{#set: molecular-weight=183.14}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-11879

  • common-name:
    • 3,4-dihydroxymandelate
  • smiles:
    • c(=o)([o-])c(c1(=cc=c(o)c(o)=c1))o
  • inchi-key:
    • rghmisiykihajw-ssdottswsa-m
  • molecular-weight:
    • 183.14

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality