Difference between revisions of "CPD-11937"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Charged-ASP-tRNAs == * common-name: ** an l-aspartyl-[trnaasp] == Reaction(s) known to consume the compound == == Reaction(s) known to pr...")
(Created page with "Category:metabolite == Metabolite CPD-11937 == * common-name: ** 1d-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate * smiles: ** c1(op([o-])(=o)[o-])(c(op([o-])(=o)...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Charged-ASP-tRNAs ==
+
== Metabolite CPD-11937 ==
 
* common-name:
 
* common-name:
** an l-aspartyl-[trnaasp]
+
** 1d-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate
 +
* smiles:
 +
** c1(op([o-])(=o)[o-])(c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])op(o)(=o)[o-])c(op([o-])([o-])=o)c(op([o-])([o-])=o)1)
 +
* inchi-key:
 +
** uphpwxpnziozjl-ptqmnwpwsa-b
 +
* molecular-weight:
 +
** 727.921
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-10973]]
 +
* [[RXN-10976]]
 +
* [[RXN-10978]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ASPARTATE--TRNA-LIGASE-RXN]]
+
* [[RXN-10971]]
 +
* [[RXN-10976]]
 +
* [[RXN-10978]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an l-aspartyl-[trnaasp]}}
+
{{#set: common-name=1d-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate}}
 +
{{#set: inchi-key=inchikey=uphpwxpnziozjl-ptqmnwpwsa-b}}
 +
{{#set: molecular-weight=727.921}}

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-11937

  • common-name:
    • 1d-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate
  • smiles:
    • c1(op([o-])(=o)[o-])(c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])op(o)(=o)[o-])c(op([o-])([o-])=o)c(op([o-])([o-])=o)1)
  • inchi-key:
    • uphpwxpnziozjl-ptqmnwpwsa-b
  • molecular-weight:
    • 727.921

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality