Difference between revisions of "CPD-11937"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AMINOPARATHION-PHOSPHATASE-RXN AMINOPARATHION-PHOSPHATASE-RXN] == * direction: ** left-to-right * c...")
(Created page with "Category:metabolite == Metabolite CPD-11937 == * common-name: ** 1d-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate * smiles: ** c1(op([o-])(=o)[o-])(c(op([o-])(=o)...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=AMINOPARATHION-PHOSPHATASE-RXN AMINOPARATHION-PHOSPHATASE-RXN] ==
+
== Metabolite CPD-11937 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** aminoparathion hydrolase
+
** 1d-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate
−
** aryldialkylphosphatase
+
* smiles:
−
* ec-number:
+
** c1(op([o-])(=o)[o-])(c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])op(o)(=o)[o-])c(op([o-])([o-])=o)c(op([o-])([o-])=o)1)
−
** [http://enzyme.expasy.org/EC/3.1.8.1 ec-3.1.8.1]
+
* inchi-key:
−
* synonymous:
+
** uphpwxpnziozjl-ptqmnwpwsa-b
−
** aminoparathion phosphatase
+
* molecular-weight:
−
** paraoxonase
+
** 727.921
−
== Reaction formula ==
+
== Reaction(s) known to consume the compound ==
−
* 1 [[AMINO-PARATHION]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD-259]][c] '''+''' 1 [[DIETHYLTHIOPHOSPHATE]][c] '''+''' 1 [[PROTON]][c]
+
* [[RXN-10973]]
−
== Gene(s) associated with this reaction  ==
+
* [[RXN-10976]]
−
* Gene: [[SJ11006]]
+
* [[RXN-10978]]
−
** Category: [[orthology]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-10971]]
−
* Gene: [[SJ15519]]
+
* [[RXN-10976]]
−
** Category: [[annotation]]
+
* [[RXN-10978]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
== Pathway(s) ==
+
{{#set: common-name=1d-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate}}
−
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=uphpwxpnziozjl-ptqmnwpwsa-b}}
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=727.921}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=aminoparathion hydrolase|aryldialkylphosphatase}}
 
−
{{#set: ec-number=ec-3.1.8.1}}
 
−
{{#set: synonymous=aminoparathion phosphatase|paraoxonase}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=orthology|annotation}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome|output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-11937

  • common-name:
    • 1d-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate
  • smiles:
    • c1(op([o-])(=o)[o-])(c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])op(o)(=o)[o-])c(op([o-])([o-])=o)c(op([o-])([o-])=o)1)
  • inchi-key:
    • uphpwxpnziozjl-ptqmnwpwsa-b
  • molecular-weight:
    • 727.921

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-11937&oldid=139191"