Difference between revisions of "CPD-11937"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14146 RXN-14146] == * direction: ** reversible * ec-number: ** [http://enzyme.expasy.org/EC/4.1...")
(Created page with "Category:metabolite == Metabolite CPD-11937 == * common-name: ** 1d-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate * smiles: ** c1(op([o-])(=o)[o-])(c(op([o-])(=o)...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14146 RXN-14146] ==
+
== Metabolite CPD-11937 ==
−
* direction:
+
* common-name:
−
** reversible
+
** 1d-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/4.1.2 ec-4.1.2]
+
** c1(op([o-])(=o)[o-])(c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])op(o)(=o)[o-])c(op([o-])([o-])=o)c(op([o-])([o-])=o)1)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-15125]][c] '''<=>''' 1 [[PYRUVATE]][c] '''+''' 1 [[SUCC-S-ALD]][c]
+
** uphpwxpnziozjl-ptqmnwpwsa-b
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ06446]]
+
** 727.921
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-10973]]
−
== Pathway(s) ==
+
* [[RXN-10976]]
−
== Reconstruction information  ==
+
* [[RXN-10978]]
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== External links  ==
+
* [[RXN-10971]]
−
* LIGAND-RXN:
+
* [[RXN-10976]]
−
** [http://www.genome.jp/dbget-bin/www_bget?R01647 R01647]
+
* [[RXN-10978]]
−
* RHEA:
+
== Reaction(s) of unknown directionality ==
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25791 25791]
+
{{#set: common-name=1d-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate}}
−
{{#set: direction=reversible}}
+
{{#set: inchi-key=inchikey=uphpwxpnziozjl-ptqmnwpwsa-b}}
−
{{#set: ec-number=ec-4.1.2}}
+
{{#set: molecular-weight=727.921}}
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-11937

  • common-name:
    • 1d-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate
  • smiles:
    • c1(op([o-])(=o)[o-])(c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])op(o)(=o)[o-])c(op([o-])([o-])=o)c(op([o-])([o-])=o)1)
  • inchi-key:
    • uphpwxpnziozjl-ptqmnwpwsa-b
  • molecular-weight:
    • 727.921

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-11937&oldid=139191"