Difference between revisions of "CPD-11938"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-5170 == * common-name: ** α-d-glc-(1→3)-α-d-glc-(1→3)-α-d-man-(1→2)-α-d-man-(1→2)-α...") |
(Created page with "Category:metabolite == Metabolite CPD-11938 == * common-name: ** 1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate * smiles: ** c1(op(=o)([o-])[o-])(c(op(=o)(...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-11938 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate |
| + | * smiles: | ||
| + | ** c1(op(=o)([o-])[o-])(c(op(=o)([o-])[o-])c(op([o-])(=o)op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(op([o-])(=o)[o-])([o-])=o)c(op([o-])([o-])=o)1) | ||
| + | * inchi-key: | ||
| + | ** hhqooerqsfjgep-slwywoedsa-a | ||
| + | * molecular-weight: | ||
| + | ** 805.885 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-10965]] |
| + | * [[RXN-10975]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[2.7.4.24-RXN]] |
| + | * [[RXN-10965]] | ||
| + | * [[RXN-10974]] | ||
| + | * [[RXN-10975]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate}} |
| + | {{#set: inchi-key=inchikey=hhqooerqsfjgep-slwywoedsa-a}} | ||
| + | {{#set: molecular-weight=805.885}} | ||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-11938
- common-name:
- 1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate
- smiles:
- c1(op(=o)([o-])[o-])(c(op(=o)([o-])[o-])c(op([o-])(=o)op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(op([o-])(=o)[o-])([o-])=o)c(op([o-])([o-])=o)1)
- inchi-key:
- hhqooerqsfjgep-slwywoedsa-a
- molecular-weight:
- 805.885
