Difference between revisions of "CPD-11938"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ08769 == * transcription-direction: ** positive * right-end-position: ** 416917 * left-end-position: ** 403567 * centisome-position: ** 93.4477...")
(Created page with "Category:metabolite == Metabolite CPD-11938 == * common-name: ** 1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate * smiles: ** c1(op(=o)([o-])[o-])(c(op(=o)(...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ08769 ==
+
== Metabolite CPD-11938 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate
−
* right-end-position:
+
* smiles:
−
** 416917
+
** c1(op(=o)([o-])[o-])(c(op(=o)([o-])[o-])c(op([o-])(=o)op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(op([o-])(=o)[o-])([o-])=o)c(op([o-])([o-])=o)1)
−
* left-end-position:
+
* inchi-key:
−
** 403567
+
** hhqooerqsfjgep-slwywoedsa-a
−
* centisome-position:
+
* molecular-weight:
−
** 93.4477   
+
** 805.885
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-10965]]
−
== Reaction(s) associated ==
+
* [[RXN-10975]]
−
* [[ATPASE-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[2.7.4.24-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-10965]]
−
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
+
* [[RXN-10974]]
−
** Category: [[annotation]]
+
* [[RXN-10975]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* [[RXN-12195]]
+
{{#set: common-name=1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=hhqooerqsfjgep-slwywoedsa-a}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=805.885}}
−
* [[RXN-12196]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN0-5462]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7210]]
 
−
** '''8''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-7198]]
 
−
** '''6''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-7184]]
 
−
** '''9''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-6545]]
 
−
** '''8''' reactions found over '''9''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=416917}}
 
−
{{#set: left-end-position=403567}}
 
−
{{#set: centisome-position=93.4477    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=5}}
 
−
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-11938

  • common-name:
    • 1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate
  • smiles:
    • c1(op(=o)([o-])[o-])(c(op(=o)([o-])[o-])c(op([o-])(=o)op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(op([o-])(=o)[o-])([o-])=o)c(op([o-])([o-])=o)1)
  • inchi-key:
    • hhqooerqsfjgep-slwywoedsa-a
  • molecular-weight:
    • 805.885

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-11938&oldid=138010"