Difference between revisions of "CPD-11938"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ18887 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 4.2.2.10-RXN ** Catego...") |
(Created page with "Category:metabolite == Metabolite CPD-11938 == * common-name: ** 1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate * smiles: ** c1(op(=o)([o-])[o-])(c(op(=o)(...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-11938 == |
| − | == | + | * common-name: |
| − | + | ** 1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate | |
| − | == Reaction(s) | + | * smiles: |
| − | * [[ | + | ** c1(op(=o)([o-])[o-])(c(op(=o)([o-])[o-])c(op([o-])(=o)op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(op([o-])(=o)[o-])([o-])=o)c(op([o-])([o-])=o)1) |
| − | * | + | * inchi-key: |
| − | * | + | ** hhqooerqsfjgep-slwywoedsa-a |
| − | * [[RXN- | + | * molecular-weight: |
| − | * | + | ** 805.885 |
| − | * | + | == Reaction(s) known to consume the compound == |
| − | == | + | * [[RXN-10965]] |
| − | + | * [[RXN-10975]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | {{#set: | + | * [[2.7.4.24-RXN]] |
| − | {{#set: | + | * [[RXN-10965]] |
| − | {{#set: | + | * [[RXN-10974]] |
| + | * [[RXN-10975]] | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate}} | ||
| + | {{#set: inchi-key=inchikey=hhqooerqsfjgep-slwywoedsa-a}} | ||
| + | {{#set: molecular-weight=805.885}} | ||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-11938
- common-name:
- 1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate
- smiles:
- c1(op(=o)([o-])[o-])(c(op(=o)([o-])[o-])c(op([o-])(=o)op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(op([o-])(=o)[o-])([o-])=o)c(op([o-])([o-])=o)1)
- inchi-key:
- hhqooerqsfjgep-slwywoedsa-a
- molecular-weight:
- 805.885
