Difference between revisions of "CPD-11938"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GAMA-TOCOPHEROL == * common-name: ** γ-tocopherol * smiles: ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=c(c)c(=c(o1)2)c)) * inchi-ke...") |
(Created page with "Category:metabolite == Metabolite CPD-11938 == * common-name: ** 1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate * smiles: ** c1(op(=o)([o-])[o-])(c(op(=o)(...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-11938 == |
* common-name: | * common-name: | ||
− | ** | + | ** 1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate |
* smiles: | * smiles: | ||
− | ** | + | ** c1(op(=o)([o-])[o-])(c(op(=o)([o-])[o-])c(op([o-])(=o)op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(op([o-])(=o)[o-])([o-])=o)c(op([o-])([o-])=o)1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** hhqooerqsfjgep-slwywoedsa-a |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 805.885 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-10965]] |
+ | * [[RXN-10975]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[2.7.4.24-RXN]] | ||
+ | * [[RXN-10965]] | ||
+ | * [[RXN-10974]] | ||
+ | * [[RXN-10975]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hhqooerqsfjgep-slwywoedsa-a}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=805.885}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-11938
- common-name:
- 1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate
- smiles:
- c1(op(=o)([o-])[o-])(c(op(=o)([o-])[o-])c(op([o-])(=o)op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(op([o-])(=o)[o-])([o-])=o)c(op([o-])([o-])=o)1)
- inchi-key:
- hhqooerqsfjgep-slwywoedsa-a
- molecular-weight:
- 805.885